C14H14Cl2N2O3 — CID 17249236
2-(2,4-dichlorophenoxy)-N-(5-methyl-1,2-oxazol-3-yl)butanamide (PubChem CID 17249236) has the molecular formula C14H14Cl2N2O3 and a molecular weight of 329.18 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-(5-methyl-1,2-oxazol-3-yl)butanamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-(5-methyl-1,2-oxazol-3-yl)butanamide |
|---|---|
| PubChem CID | 17249236 |
| Molecular Formula | C14H14Cl2N2O3 |
| Molecular Weight | 329.18 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-(5-methyl-1,2-oxazol-3-yl)butanamide |
| SMILES | CCC(Oc1ccc(Cl)cc1Cl)C(=O)Nc1cc(C)on1 |
| InChI | InChI=1S/C14H14Cl2N2O3/c1-3-11(14(19)17-13-6-8(2)21-18-13)20-12-5-4-9(15)7-10(12)16/h4-7,11H,3H2,1-2H3,(H,17,18,19) |
| InChIKey | OEFYUVQLWMZKIQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.18 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |