C15H17N3O4 — CID 17430036
2-[1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxobutan-2-yl]oxybenzamide (PubChem CID 17430036) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is 2-[1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxobutan-2-yl]oxybenzamide.
| Compound Name | 2-[1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxobutan-2-yl]oxybenzamide |
|---|---|
| PubChem CID | 17430036 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 2-[1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxobutan-2-yl]oxybenzamide |
| SMILES | CCC(Oc1ccccc1C(N)=O)C(=O)Nc1cc(C)on1 |
| InChI | InChI=1S/C15H17N3O4/c1-3-11(15(20)17-13-8-9(2)22-18-13)21-12-7-5-4-6-10(12)14(16)19/h4-8,11H,3H2,1-2H3,(H2,16,19)(H,17,18,20) |
| InChIKey | CZGDEPWQSGCMPN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |