C15H14ClN3O6 — CID 51862492
[(2R)-1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxobutan-2-yl] 4-chloro-2-nitrobenzoate (PubChem CID 51862492) has the molecular formula C15H14ClN3O6 and a molecular weight of 367.75 g/mol. Its IUPAC name is [(2R)-1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxobutan-2-yl] 4-chloro-2-nitrobenzoate.
| Compound Name | [(2R)-1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxobutan-2-yl] 4-chloro-2-nitrobenzoate |
|---|---|
| PubChem CID | 51862492 |
| Molecular Formula | C15H14ClN3O6 |
| Molecular Weight | 367.75 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | [(2R)-1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxobutan-2-yl] 4-chloro-2-nitrobenzoate |
| SMILES | CC[C@@H](OC(=O)c1ccc(Cl)cc1[N+](=O)[O-])C(=O)Nc1cc(C)on1 |
| InChI | InChI=1S/C15H14ClN3O6/c1-3-12(14(20)17-13-6-8(2)25-18-13)24-15(21)10-5-4-9(16)7-11(10)19(22)23/h4-7,12H,3H2,1-2H3,(H,17,18,20)/t12-/m1/s1 |
| InChIKey | RGVRJIXKHOWGSE-GFCCVEGCSA-N |
| XLogP | 3.12 |
| TPSA | 124.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.75 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|