C16H17N3O8S — CID 24526449
[1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxobutan-2-yl] 4-methylsulfonyl-3-nitrobenzoate (PubChem CID 24526449) has the molecular formula C16H17N3O8S and a molecular weight of 411.39 g/mol. Its IUPAC name is [1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxobutan-2-yl] 4-methylsulfonyl-3-nitrobenzoate.
| Compound Name | [1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxobutan-2-yl] 4-methylsulfonyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 24526449 |
| Molecular Formula | C16H17N3O8S |
| Molecular Weight | 411.39 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | [1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxobutan-2-yl] 4-methylsulfonyl-3-nitrobenzoate |
| SMILES | CCC(OC(=O)c1ccc(S(C)(=O)=O)c([N+](=O)[O-])c1)C(=O)Nc1cc(C)on1 |
| InChI | InChI=1S/C16H17N3O8S/c1-4-12(15(20)17-14-7-9(2)27-18-14)26-16(21)10-5-6-13(28(3,24)25)11(8-10)19(22)23/h5-8,12H,4H2,1-3H3,(H,17,18,20) |
| InChIKey | HOFXXVGMNYWBAF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 158.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|