C14H15ClN2O3 — CID 27233481
(2S)-2-(4-chloro-3-methylphenoxy)-N-(1,2-oxazol-3-yl)butanamide (PubChem CID 27233481) has the molecular formula C14H15ClN2O3 and a molecular weight of 294.74 g/mol. Its IUPAC name is (2S)-2-(4-chloro-3-methylphenoxy)-N-(1,2-oxazol-3-yl)butanamide.
| Compound Name | (2S)-2-(4-chloro-3-methylphenoxy)-N-(1,2-oxazol-3-yl)butanamide |
|---|---|
| PubChem CID | 27233481 |
| Molecular Formula | C14H15ClN2O3 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | (2S)-2-(4-chloro-3-methylphenoxy)-N-(1,2-oxazol-3-yl)butanamide |
| SMILES | CC[C@H](Oc1ccc(Cl)c(C)c1)C(=O)Nc1ccon1 |
| InChI | InChI=1S/C14H15ClN2O3/c1-3-12(14(18)16-13-6-7-19-17-13)20-10-4-5-11(15)9(2)8-10/h4-8,12H,3H2,1-2H3,(H,16,17,18)/t12-/m0/s1 |
| InChIKey | IZHOTZXQBNYUEI-LBPRGKRZSA-N |
| XLogP | 3.43 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |