C10H8FN3O2 — CID 6470703
1-(4-fluorophenyl)-3-(1,2-oxazol-3-yl)urea (PubChem CID 6470703) has the molecular formula C10H8FN3O2 and a molecular weight of 221.19 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-(1,2-oxazol-3-yl)urea.
| Compound Name | 1-(4-fluorophenyl)-3-(1,2-oxazol-3-yl)urea |
|---|---|
| PubChem CID | 6470703 |
| Molecular Formula | C10H8FN3O2 |
| Molecular Weight | 221.19 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 1-(4-fluorophenyl)-3-(1,2-oxazol-3-yl)urea |
| SMILES | O=C(Nc1ccc(F)cc1)Nc1ccon1 |
| InChI | InChI=1S/C10H8FN3O2/c11-7-1-3-8(4-2-7)12-10(15)13-9-5-6-16-14-9/h1-6H,(H2,12,13,14,15) |
| InChIKey | SLJSXXBASIKZOL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.19 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |