C15H20N4O2 — CID 62902901
1-(1,2-oxazol-3-yl)-3-[4-[1-(propylamino)ethyl]phenyl]urea (PubChem CID 62902901) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 1-(1,2-oxazol-3-yl)-3-[4-[1-(propylamino)ethyl]phenyl]urea.
| Compound Name | 1-(1,2-oxazol-3-yl)-3-[4-[1-(propylamino)ethyl]phenyl]urea |
|---|---|
| PubChem CID | 62902901 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 1-(1,2-oxazol-3-yl)-3-[4-[1-(propylamino)ethyl]phenyl]urea |
| SMILES | CCCNC(C)c1ccc(NC(=O)Nc2ccon2)cc1 |
| InChI | InChI=1S/C15H20N4O2/c1-3-9-16-11(2)12-4-6-13(7-5-12)17-15(20)18-14-8-10-21-19-14/h4-8,10-11,16H,3,9H2,1-2H3,(H2,17,18,19,20) |
| InChIKey | HURTZSGIGYMKFH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |