methyl 4-(1,2-oxazol-3-ylcarbamoylamino)benzoate

C12H11N3O4 — CID 108811946

IUPACmethyl 4-(1,2-oxazol-3-ylcarbamoylamino)benzoate
SMILESCOC(=O)c1ccc(NC(=O)Nc2ccon2)cc1
InChIInChI=1S/C12H11N3O4/c1-18-11(16)8-2-4-9(5-3-8)13-12(17)14-10-6-7-19-15-10/h2-7H,1H3,(H2,13,14,15,17)
InChIKeyUBCBYXWMCYRHFR-UHFFFAOYSA-N
MW261.24 g/mol
LogP2.11
Rot. Bonds3

About methyl 4-(1,2-oxazol-3-ylcarbamoylamino)benzoate

methyl 4-(1,2-oxazol-3-ylcarbamoylamino)benzoate (PubChem CID 108811946) has the molecular formula C12H11N3O4 and a molecular weight of 261.24 g/mol. Its IUPAC name is methyl 4-(1,2-oxazol-3-ylcarbamoylamino)benzoate.

Molecular Properties

Compound Namemethyl 4-(1,2-oxazol-3-ylcarbamoylamino)benzoate
PubChem CID108811946
Molecular FormulaC12H11N3O4
Molecular Weight261.24 g/mol
Exact Mass261.07
IUPAC Namemethyl 4-(1,2-oxazol-3-ylcarbamoylamino)benzoate
SMILESCOC(=O)c1ccc(NC(=O)Nc2ccon2)cc1
InChIInChI=1S/C12H11N3O4/c1-18-11(16)8-2-4-9(5-3-8)13-12(17)14-10-6-7-19-15-10/h2-7H,1H3,(H2,13,14,15,17)
InChIKeyUBCBYXWMCYRHFR-UHFFFAOYSA-N
XLogP2.11
TPSA93.46 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.24
LogP ≤ 52.11
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze methyl 4-(1,2-oxazol-3-ylcarbamoylamino)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(1,2-oxazol-3-ylcarbamoylamino)benzoate?
The IUPAC name of methyl 4-(1,2-oxazol-3-ylcarbamoylamino)benzoate (CID 108811946) is methyl 4-(1,2-oxazol-3-ylcarbamoylamino)benzoate.
What is the SMILES notation for methyl 4-(1,2-oxazol-3-ylcarbamoylamino)benzoate?
The canonical SMILES for methyl 4-(1,2-oxazol-3-ylcarbamoylamino)benzoate is COC(=O)c1ccc(NC(=O)Nc2ccon2)cc1.
What is the InChIKey of methyl 4-(1,2-oxazol-3-ylcarbamoylamino)benzoate?
The InChIKey is UBCBYXWMCYRHFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3O4/c1-18-11(16)8-2-4-9(5-3-8)13-12(17)14-10-6-7-19-15-10/h2-7H,1H3,(H2,13,14,15,17).
What are the key properties of methyl 4-(1,2-oxazol-3-ylcarbamoylamino)benzoate?
methyl 4-(1,2-oxazol-3-ylcarbamoylamino)benzoate has a molecular weight of 261.24 g/mol, XLogP of 2.11, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(1,2-oxazol-3-ylcarbamoylamino)benzoate is sourced from PubChem (CID 108811946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).