C12H7F6N3O2 — CID 108811972
1-[3,5-bis(trifluoromethyl)phenyl]-3-(1,2-oxazol-3-yl)urea (PubChem CID 108811972) has the molecular formula C12H7F6N3O2 and a molecular weight of 339.20 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-(1,2-oxazol-3-yl)urea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-(1,2-oxazol-3-yl)urea |
|---|---|
| PubChem CID | 108811972 |
| Molecular Formula | C12H7F6N3O2 |
| Molecular Weight | 339.20 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-(1,2-oxazol-3-yl)urea |
| SMILES | O=C(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)Nc1ccon1 |
| InChI | InChI=1S/C12H7F6N3O2/c13-11(14,15)6-3-7(12(16,17)18)5-8(4-6)19-10(22)20-9-1-2-23-21-9/h1-5H,(H2,19,20,21,22) |
| InChIKey | JXLCEPGQKJUHSD-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.20 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |