C10H7ClFN3O2 — CID 6465329
1-(3-chloro-4-fluorophenyl)-3-(1,2-oxazol-3-yl)urea (PubChem CID 6465329) has the molecular formula C10H7ClFN3O2 and a molecular weight of 255.64 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-(1,2-oxazol-3-yl)urea.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-(1,2-oxazol-3-yl)urea |
|---|---|
| PubChem CID | 6465329 |
| Molecular Formula | C10H7ClFN3O2 |
| Molecular Weight | 255.64 g/mol |
| Exact Mass | 255.02 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-(1,2-oxazol-3-yl)urea |
| SMILES | O=C(Nc1ccc(F)c(Cl)c1)Nc1ccon1 |
| InChI | InChI=1S/C10H7ClFN3O2/c11-7-5-6(1-2-8(7)12)13-10(16)14-9-3-4-17-15-9/h1-5H,(H2,13,14,15,16) |
| InChIKey | TZFOSMGRMYLSSA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.64 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |