C12H12ClFN4O — CID 108813456
1-(3-chloro-4-fluorophenyl)-3-(1,5-dimethylpyrazol-3-yl)urea (PubChem CID 108813456) has the molecular formula C12H12ClFN4O and a molecular weight of 282.71 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-(1,5-dimethylpyrazol-3-yl)urea.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-(1,5-dimethylpyrazol-3-yl)urea |
|---|---|
| PubChem CID | 108813456 |
| Molecular Formula | C12H12ClFN4O |
| Molecular Weight | 282.71 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-(1,5-dimethylpyrazol-3-yl)urea |
| SMILES | Cc1cc(NC(=O)Nc2ccc(F)c(Cl)c2)nn1C |
| InChI | InChI=1S/C12H12ClFN4O/c1-7-5-11(17-18(7)2)16-12(19)15-8-3-4-10(14)9(13)6-8/h3-6H,1-2H3,(H2,15,16,17,19) |
| InChIKey | SVMJHGPTUPRPGA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.71 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |