C13H9BrF3N3O — CID 102820650
1-(4-bromo-2-pyridinyl)-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 102820650) has the molecular formula C13H9BrF3N3O and a molecular weight of 360.13 g/mol. Its IUPAC name is 1-(4-bromo-2-pyridinyl)-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(4-bromo-2-pyridinyl)-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 102820650 |
| Molecular Formula | C13H9BrF3N3O |
| Molecular Weight | 360.13 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | 1-(4-bromo-2-pyridinyl)-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)Nc1cc(Br)ccn1 |
| InChI | InChI=1S/C13H9BrF3N3O/c14-9-4-5-18-11(7-9)20-12(21)19-10-3-1-2-8(6-10)13(15,16)17/h1-7H,(H2,18,19,20,21) |
| InChIKey | ZZGSPRIRDJCNRA-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.13 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |