C13H13N3O3 — CID 41452995
N-(1,2-oxazol-3-yl)-N'-[(1R)-1-phenylethyl]oxamide (PubChem CID 41452995) has the molecular formula C13H13N3O3 and a molecular weight of 259.26 g/mol. Its IUPAC name is N-(1,2-oxazol-3-yl)-N'-[(1R)-1-phenylethyl]oxamide.
| Compound Name | N-(1,2-oxazol-3-yl)-N'-[(1R)-1-phenylethyl]oxamide |
|---|---|
| PubChem CID | 41452995 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | N-(1,2-oxazol-3-yl)-N'-[(1R)-1-phenylethyl]oxamide |
| SMILES | C[C@@H](NC(=O)C(=O)Nc1ccon1)c1ccccc1 |
| InChI | InChI=1S/C13H13N3O3/c1-9(10-5-3-2-4-6-10)14-12(17)13(18)15-11-7-8-19-16-11/h2-9H,1H3,(H,14,17)(H,15,16,18)/t9-/m1/s1 |
| InChIKey | LKIXYASABBXJNH-SECBINFHSA-N |
| XLogP | 1.49 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|