C16H17N3O2 — CID 44997207
N-(5-methyl-2-pyridinyl)-N'-(1-phenylethyl)oxamide (PubChem CID 44997207) has the molecular formula C16H17N3O2 and a molecular weight of 283.33 g/mol. Its IUPAC name is N-(5-methyl-2-pyridinyl)-N'-(1-phenylethyl)oxamide.
| Compound Name | N-(5-methyl-2-pyridinyl)-N'-(1-phenylethyl)oxamide |
|---|---|
| PubChem CID | 44997207 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | N-(5-methyl-2-pyridinyl)-N'-(1-phenylethyl)oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)NC(C)c2ccccc2)nc1 |
| InChI | InChI=1S/C16H17N3O2/c1-11-8-9-14(17-10-11)19-16(21)15(20)18-12(2)13-6-4-3-5-7-13/h3-10,12H,1-2H3,(H,18,20)(H,17,19,21) |
| InChIKey | OCOUCOPRXBQLBY-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|