C16H15IN2O2 — CID 108507943
N-(4-iodophenyl)-N'-(1-phenylethyl)oxamide (PubChem CID 108507943) has the molecular formula C16H15IN2O2 and a molecular weight of 394.21 g/mol. Its IUPAC name is N-(4-iodophenyl)-N'-(1-phenylethyl)oxamide.
| Compound Name | N-(4-iodophenyl)-N'-(1-phenylethyl)oxamide |
|---|---|
| PubChem CID | 108507943 |
| Molecular Formula | C16H15IN2O2 |
| Molecular Weight | 394.21 g/mol |
| Exact Mass | 394.02 |
| IUPAC Name | N-(4-iodophenyl)-N'-(1-phenylethyl)oxamide |
| SMILES | CC(NC(=O)C(=O)Nc1ccc(I)cc1)c1ccccc1 |
| InChI | InChI=1S/C16H15IN2O2/c1-11(12-5-3-2-4-6-12)18-15(20)16(21)19-14-9-7-13(17)8-10-14/h2-11H,1H3,(H,18,20)(H,19,21) |
| InChIKey | VMNRUXIUBBYRKH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.21 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|