C19H20N4O3 — CID 51053458
N-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-N'-[(1S)-1-phenylethyl]oxamide (PubChem CID 51053458) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is N-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-N'-[(1S)-1-phenylethyl]oxamide.
| Compound Name | N-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-N'-[(1S)-1-phenylethyl]oxamide |
|---|---|
| PubChem CID | 51053458 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | N-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-N'-[(1S)-1-phenylethyl]oxamide |
| SMILES | C[C@H](NC(=O)C(=O)Nc1ccc2c(c1)n(C)c(=O)n2C)c1ccccc1 |
| InChI | InChI=1S/C19H20N4O3/c1-12(13-7-5-4-6-8-13)20-17(24)18(25)21-14-9-10-15-16(11-14)23(3)19(26)22(15)2/h4-12H,1-3H3,(H,20,24)(H,21,25)/t12-/m0/s1 |
| InChIKey | UNINUOWPCZUSTA-LBPRGKRZSA-N |
| XLogP | 1.69 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|