C22H27N5O4 — CID 52996681
N-[2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]-N'-(1,3-dimethyl-2-oxobenzimidazol-5-yl)oxamide (PubChem CID 52996681) has the molecular formula C22H27N5O4 and a molecular weight of 425.49 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]-N'-(1,3-dimethyl-2-oxobenzimidazol-5-yl)oxamide.
| Compound Name | N-[2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]-N'-(1,3-dimethyl-2-oxobenzimidazol-5-yl)oxamide |
|---|---|
| PubChem CID | 52996681 |
| Molecular Formula | C22H27N5O4 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | N-[2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]-N'-(1,3-dimethyl-2-oxobenzimidazol-5-yl)oxamide |
| SMILES | COc1ccc(C(CNC(=O)C(=O)Nc2ccc3c(c2)n(C)c(=O)n3C)N(C)C)cc1 |
| InChI | InChI=1S/C22H27N5O4/c1-25(2)19(14-6-9-16(31-5)10-7-14)13-23-20(28)21(29)24-15-8-11-17-18(12-15)27(4)22(30)26(17)3/h6-12,19H,13H2,1-5H3,(H,23,28)(H,24,29) |
| InChIKey | JGKJBXKPKNJEKL-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|