C19H24N4O4 — CID 51971308
N-[(2R)-2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]-N'-(6-methoxy-3-pyridinyl)oxamide (PubChem CID 51971308) has the molecular formula C19H24N4O4 and a molecular weight of 372.43 g/mol. Its IUPAC name is N-[(2R)-2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]-N'-(6-methoxy-3-pyridinyl)oxamide.
| Compound Name | N-[(2R)-2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]-N'-(6-methoxy-3-pyridinyl)oxamide |
|---|---|
| PubChem CID | 51971308 |
| Molecular Formula | C19H24N4O4 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | N-[(2R)-2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]-N'-(6-methoxy-3-pyridinyl)oxamide |
| SMILES | COc1ccc([C@H](CNC(=O)C(=O)Nc2ccc(OC)nc2)N(C)C)cc1 |
| InChI | InChI=1S/C19H24N4O4/c1-23(2)16(13-5-8-15(26-3)9-6-13)12-21-18(24)19(25)22-14-7-10-17(27-4)20-11-14/h5-11,16H,12H2,1-4H3,(H,21,24)(H,22,25)/t16-/m0/s1 |
| InChIKey | FXANEZJTIOLCOB-INIZCTEOSA-N |
| XLogP | 1.46 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|