C19H25N3O3 — CID 51168501
1-[2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]-3-(2-methoxyphenyl)urea (PubChem CID 51168501) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is 1-[2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]-3-(2-methoxyphenyl)urea.
| Compound Name | 1-[2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]-3-(2-methoxyphenyl)urea |
|---|---|
| PubChem CID | 51168501 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 1-[2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]-3-(2-methoxyphenyl)urea |
| SMILES | COc1ccc(C(CNC(=O)Nc2ccccc2OC)N(C)C)cc1 |
| InChI | InChI=1S/C19H25N3O3/c1-22(2)17(14-9-11-15(24-3)12-10-14)13-20-19(23)21-16-7-5-6-8-18(16)25-4/h5-12,17H,13H2,1-4H3,(H2,20,21,23) |
| InChIKey | DDCMSLPCAXASIW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |