C19H24ClN3O3 — CID 55697126
1-(5-chloro-2-methoxyphenyl)-3-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]urea (PubChem CID 55697126) has the molecular formula C19H24ClN3O3 and a molecular weight of 377.87 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-3-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]urea.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-3-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 55697126 |
| Molecular Formula | C19H24ClN3O3 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-3-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]urea |
| SMILES | COc1cccc(C(CNC(=O)Nc2cc(Cl)ccc2OC)N(C)C)c1 |
| InChI | InChI=1S/C19H24ClN3O3/c1-23(2)17(13-6-5-7-15(10-13)25-3)12-21-19(24)22-16-11-14(20)8-9-18(16)26-4/h5-11,17H,12H2,1-4H3,(H2,21,22,24) |
| InChIKey | DSQFRVQHZRDZNX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |