C18H21Cl2N3O2 — CID 24528863
1-(3,4-dichlorophenyl)-3-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]urea (PubChem CID 24528863) has the molecular formula C18H21Cl2N3O2 and a molecular weight of 382.29 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 24528863 |
| Molecular Formula | C18H21Cl2N3O2 |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]urea |
| SMILES | COc1cccc(C(CNC(=O)Nc2ccc(Cl)c(Cl)c2)N(C)C)c1 |
| InChI | InChI=1S/C18H21Cl2N3O2/c1-23(2)17(12-5-4-6-14(9-12)25-3)11-21-18(24)22-13-7-8-15(19)16(20)10-13/h4-10,17H,11H2,1-3H3,(H2,21,22,24) |
| InChIKey | HZNTYQXASIIZNM-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |