C16H18Cl2N4O — CID 20856780
1-(3,4-dichlorophenyl)-3-[2-(dimethylamino)-2-pyridin-3-ylethyl]urea (PubChem CID 20856780) has the molecular formula C16H18Cl2N4O and a molecular weight of 353.25 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[2-(dimethylamino)-2-pyridin-3-ylethyl]urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[2-(dimethylamino)-2-pyridin-3-ylethyl]urea |
|---|---|
| PubChem CID | 20856780 |
| Molecular Formula | C16H18Cl2N4O |
| Molecular Weight | 353.25 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[2-(dimethylamino)-2-pyridin-3-ylethyl]urea |
| SMILES | CN(C)C(CNC(=O)Nc1ccc(Cl)c(Cl)c1)c1cccnc1 |
| InChI | InChI=1S/C16H18Cl2N4O/c1-22(2)15(11-4-3-7-19-9-11)10-20-16(23)21-12-5-6-13(17)14(18)8-12/h3-9,15H,10H2,1-2H3,(H2,20,21,23) |
| InChIKey | GGRRXPCIQGULDQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.25 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |