C19H23N3O4 — CID 51971716
N-[(2S)-2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]-N'-(3-hydroxyphenyl)oxamide (PubChem CID 51971716) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is N-[(2S)-2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]-N'-(3-hydroxyphenyl)oxamide.
| Compound Name | N-[(2S)-2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]-N'-(3-hydroxyphenyl)oxamide |
|---|---|
| PubChem CID | 51971716 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | N-[(2S)-2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]-N'-(3-hydroxyphenyl)oxamide |
| SMILES | COc1ccc([C@@H](CNC(=O)C(=O)Nc2cccc(O)c2)N(C)C)cc1 |
| InChI | InChI=1S/C19H23N3O4/c1-22(2)17(13-7-9-16(26-3)10-8-13)12-20-18(24)19(25)21-14-5-4-6-15(23)11-14/h4-11,17,23H,12H2,1-3H3,(H,20,24)(H,21,25)/t17-/m1/s1 |
| InChIKey | GGILLFUZYLHLCD-QGZVFWFLSA-N |
| XLogP | 1.76 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|