C18H22N4O4 — CID 51043301
N-[2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]-N'-(4-oxo-1H-pyridin-3-yl)oxamide (PubChem CID 51043301) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]-N'-(4-oxo-1H-pyridin-3-yl)oxamide.
| Compound Name | N-[2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]-N'-(4-oxo-1H-pyridin-3-yl)oxamide |
|---|---|
| PubChem CID | 51043301 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | N-[2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]-N'-(4-oxo-1H-pyridin-3-yl)oxamide |
| SMILES | COc1ccc(C(CNC(=O)C(=O)Nc2c[nH]ccc2=O)N(C)C)cc1 |
| InChI | InChI=1S/C18H22N4O4/c1-22(2)15(12-4-6-13(26-3)7-5-12)11-20-17(24)18(25)21-14-10-19-9-8-16(14)23/h4-10,15H,11H2,1-3H3,(H,19,23)(H,20,24)(H,21,25) |
| InChIKey | LFAMRLRLWAFIHQ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|