C21H24N4O5 — CID 49295966
N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-(1,3-dimethyl-2-oxobenzimidazol-5-yl)oxamide (PubChem CID 49295966) has the molecular formula C21H24N4O5 and a molecular weight of 412.45 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-(1,3-dimethyl-2-oxobenzimidazol-5-yl)oxamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-(1,3-dimethyl-2-oxobenzimidazol-5-yl)oxamide |
|---|---|
| PubChem CID | 49295966 |
| Molecular Formula | C21H24N4O5 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-(1,3-dimethyl-2-oxobenzimidazol-5-yl)oxamide |
| SMILES | COc1ccc(CCNC(=O)C(=O)Nc2ccc3c(c2)n(C)c(=O)n3C)cc1OC |
| InChI | InChI=1S/C21H24N4O5/c1-24-15-7-6-14(12-16(15)25(2)21(24)28)23-20(27)19(26)22-10-9-13-5-8-17(29-3)18(11-13)30-4/h5-8,11-12H,9-10H2,1-4H3,(H,22,26)(H,23,27) |
| InChIKey | HWQCPBTWBDRCBE-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|