C19H20N2O6 — CID 2291128
N'-(1,3-benzodioxol-5-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]oxamide (PubChem CID 2291128) has the molecular formula C19H20N2O6 and a molecular weight of 372.38 g/mol. Its IUPAC name is N'-(1,3-benzodioxol-5-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]oxamide.
| Compound Name | N'-(1,3-benzodioxol-5-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 2291128 |
| Molecular Formula | C19H20N2O6 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | N'-(1,3-benzodioxol-5-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]oxamide |
| SMILES | COc1ccc(CCNC(=O)C(=O)Nc2ccc3c(c2)OCO3)cc1OC |
| InChI | InChI=1S/C19H20N2O6/c1-24-14-5-3-12(9-16(14)25-2)7-8-20-18(22)19(23)21-13-4-6-15-17(10-13)27-11-26-15/h3-6,9-10H,7-8,11H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | IZTRNTPRTUVZQO-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|