C25H25IN2O2 — CID 40592995
(2R)-2-[(2,2-diphenylacetyl)amino]-N-(4-iodophenyl)-3-methylbutanamide (PubChem CID 40592995) has the molecular formula C25H25IN2O2 and a molecular weight of 512.39 g/mol. Its IUPAC name is (2R)-2-[(2,2-diphenylacetyl)amino]-N-(4-iodophenyl)-3-methylbutanamide.
| Compound Name | (2R)-2-[(2,2-diphenylacetyl)amino]-N-(4-iodophenyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 40592995 |
| Molecular Formula | C25H25IN2O2 |
| Molecular Weight | 512.39 g/mol |
| Exact Mass | 512.10 |
| IUPAC Name | (2R)-2-[(2,2-diphenylacetyl)amino]-N-(4-iodophenyl)-3-methylbutanamide |
| SMILES | CC(C)[C@@H](NC(=O)C(c1ccccc1)c1ccccc1)C(=O)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C25H25IN2O2/c1-17(2)23(25(30)27-21-15-13-20(26)14-16-21)28-24(29)22(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-17,22-23H,1-2H3,(H,27,30)(H,28,29)/t23-/m1/s1 |
| InChIKey | YIYSSWGWZAWHNI-HSZRJFAPSA-N |
| XLogP | 5.20 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.39 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|