C23H30N2O2 — CID 126008908
(2S)-N-[(2S)-butan-2-yl]-2-[(2,2-diphenylacetyl)amino]-3-methylbutanamide (PubChem CID 126008908) has the molecular formula C23H30N2O2 and a molecular weight of 366.50 g/mol. Its IUPAC name is (2S)-N-[(2S)-butan-2-yl]-2-[(2,2-diphenylacetyl)amino]-3-methylbutanamide.
| Compound Name | (2S)-N-[(2S)-butan-2-yl]-2-[(2,2-diphenylacetyl)amino]-3-methylbutanamide |
|---|---|
| PubChem CID | 126008908 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | (2S)-N-[(2S)-butan-2-yl]-2-[(2,2-diphenylacetyl)amino]-3-methylbutanamide |
| SMILES | CC[C@H](C)NC(=O)[C@@H](NC(=O)C(c1ccccc1)c1ccccc1)C(C)C |
| InChI | InChI=1S/C23H30N2O2/c1-5-17(4)24-23(27)21(16(2)3)25-22(26)20(18-12-8-6-9-13-18)19-14-10-7-11-15-19/h6-17,20-21H,5H2,1-4H3,(H,24,27)(H,25,26)/t17-,21-/m0/s1 |
| InChIKey | NAQUEPRSZRMKAL-UWJYYQICSA-N |
| XLogP | 3.87 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |