C16H23IN2O3 — CID 102474491
tert-butyl N-[(2S)-1-(4-iodoanilino)-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 102474491) has the molecular formula C16H23IN2O3 and a molecular weight of 418.28 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(4-iodoanilino)-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(4-iodoanilino)-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 102474491 |
| Molecular Formula | C16H23IN2O3 |
| Molecular Weight | 418.28 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | tert-butyl N-[(2S)-1-(4-iodoanilino)-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)[C@H](NC(=O)OC(C)(C)C)C(=O)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C16H23IN2O3/c1-10(2)13(19-15(21)22-16(3,4)5)14(20)18-12-8-6-11(17)7-9-12/h6-10,13H,1-5H3,(H,18,20)(H,19,21)/t13-/m0/s1 |
| InChIKey | LCRKFVFSAPEDMP-ZDUSSCGKSA-N |
| XLogP | 3.78 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.28 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|