C11H15ClN2O — CID 88902411
(2S)-2-(chloroamino)-3-methyl-N-phenylbutanamide (PubChem CID 88902411) has the molecular formula C11H15ClN2O and a molecular weight of 226.71 g/mol. Its IUPAC name is (2S)-2-(chloroamino)-3-methyl-N-phenylbutanamide.
| Compound Name | (2S)-2-(chloroamino)-3-methyl-N-phenylbutanamide |
|---|---|
| PubChem CID | 88902411 |
| Molecular Formula | C11H15ClN2O |
| Molecular Weight | 226.71 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | (2S)-2-(chloroamino)-3-methyl-N-phenylbutanamide |
| SMILES | CC(C)[C@H](NCl)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C11H15ClN2O/c1-8(2)10(14-12)11(15)13-9-6-4-3-5-7-9/h3-8,10,14H,1-2H3,(H,13,15)/t10-/m0/s1 |
| InChIKey | UDKMVHNOCQGCEJ-JTQLQIEISA-N |
| XLogP | 2.39 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.71 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|