C6H13ClN2O — CID 88902514
(2R)-2-(chloroamino)-N,3-dimethylbutanamide (PubChem CID 88902514) has the molecular formula C6H13ClN2O and a molecular weight of 164.64 g/mol. Its IUPAC name is (2R)-2-(chloroamino)-N,3-dimethylbutanamide.
| Compound Name | (2R)-2-(chloroamino)-N,3-dimethylbutanamide |
|---|---|
| PubChem CID | 88902514 |
| Molecular Formula | C6H13ClN2O |
| Molecular Weight | 164.64 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | (2R)-2-(chloroamino)-N,3-dimethylbutanamide |
| SMILES | CNC(=O)[C@H](NCl)C(C)C |
| InChI | InChI=1S/C6H13ClN2O/c1-4(2)5(9-7)6(10)8-3/h4-5,9H,1-3H3,(H,8,10)/t5-/m1/s1 |
| InChIKey | LXDGBOVNDKPTLP-RXMQYKEDSA-N |
| XLogP | 0.50 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.64 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|