C12H25N3O2 — CID 145135261
(2S)-3-methyl-2-(methylamino)-N-[3-methyl-1-(methylamino)-1-oxobutan-2-yl]butanamide (PubChem CID 145135261) has the molecular formula C12H25N3O2 and a molecular weight of 243.35 g/mol. Its IUPAC name is (2S)-3-methyl-2-(methylamino)-N-[3-methyl-1-(methylamino)-1-oxobutan-2-yl]butanamide.
| Compound Name | (2S)-3-methyl-2-(methylamino)-N-[3-methyl-1-(methylamino)-1-oxobutan-2-yl]butanamide |
|---|---|
| PubChem CID | 145135261 |
| Molecular Formula | C12H25N3O2 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.19 |
| IUPAC Name | (2S)-3-methyl-2-(methylamino)-N-[3-methyl-1-(methylamino)-1-oxobutan-2-yl]butanamide |
| SMILES | CNC(=O)C(NC(=O)[C@@H](NC)C(C)C)C(C)C |
| InChI | InChI=1S/C12H25N3O2/c1-7(2)9(13-5)12(17)15-10(8(3)4)11(16)14-6/h7-10,13H,1-6H3,(H,14,16)(H,15,17)/t9-,10?/m0/s1 |
| InChIKey | AWKKTSYDOXSOIA-RGURZIINSA-N |
| XLogP | 0.12 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |