C9H17IN2O2 — CID 155401923
(2S)-2-[[(2S)-3-methyl-2-(methylamino)butanoyl]amino]propanoyl iodide (PubChem CID 155401923) has the molecular formula C9H17IN2O2 and a molecular weight of 312.15 g/mol. Its IUPAC name is (2S)-2-[[(2S)-3-methyl-2-(methylamino)butanoyl]amino]propanoyl iodide.
| Compound Name | (2S)-2-[[(2S)-3-methyl-2-(methylamino)butanoyl]amino]propanoyl iodide |
|---|---|
| PubChem CID | 155401923 |
| Molecular Formula | C9H17IN2O2 |
| Molecular Weight | 312.15 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | (2S)-2-[[(2S)-3-methyl-2-(methylamino)butanoyl]amino]propanoyl iodide |
| SMILES | CN[C@H](C(=O)N[C@@H](C)C(=O)I)C(C)C |
| InChI | InChI=1S/C9H17IN2O2/c1-5(2)7(11-4)9(14)12-6(3)8(10)13/h5-7,11H,1-4H3,(H,12,14)/t6-,7-/m0/s1 |
| InChIKey | MFQIIDIJQTXDRY-BQBZGAKWSA-N |
| XLogP | 0.70 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.15 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|