C10H17IN2O4 — CID 87405364
2-[[2-[(2-iodoacetyl)amino]-3-methylbutanoyl]amino]propanoic acid (PubChem CID 87405364) has the molecular formula C10H17IN2O4 and a molecular weight of 356.16 g/mol. Its IUPAC name is 2-[[2-[(2-iodoacetyl)amino]-3-methylbutanoyl]amino]propanoic acid.
| Compound Name | 2-[[2-[(2-iodoacetyl)amino]-3-methylbutanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 87405364 |
| Molecular Formula | C10H17IN2O4 |
| Molecular Weight | 356.16 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | 2-[[2-[(2-iodoacetyl)amino]-3-methylbutanoyl]amino]propanoic acid |
| SMILES | CC(NC(=O)C(NC(=O)CI)C(C)C)C(=O)O |
| InChI | InChI=1S/C10H17IN2O4/c1-5(2)8(13-7(14)4-11)9(15)12-6(3)10(16)17/h5-6,8H,4H2,1-3H3,(H,12,15)(H,13,14)(H,16,17) |
| InChIKey | UNDFCBUCFYQFAZ-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.16 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|