C12H22N4O5 — CID 18487868
2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-methylbutanoyl]amino]propanoic acid (PubChem CID 18487868) has the molecular formula C12H22N4O5 and a molecular weight of 302.33 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-methylbutanoyl]amino]propanoic acid.
| Compound Name | 2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-methylbutanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 18487868 |
| Molecular Formula | C12H22N4O5 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-methylbutanoyl]amino]propanoic acid |
| SMILES | CC(NC(=O)C(NC(=O)CNC(=O)CN)C(C)C)C(=O)O |
| InChI | InChI=1S/C12H22N4O5/c1-6(2)10(11(19)15-7(3)12(20)21)16-9(18)5-14-8(17)4-13/h6-7,10H,4-5,13H2,1-3H3,(H,14,17)(H,15,19)(H,16,18)(H,20,21) |
| InChIKey | XPLWZXDRBSBERN-UHFFFAOYSA-N |
| XLogP | -2.21 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |