C10H18N4O5 — CID 18487522
2-[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]propanoylamino]propanoic acid (PubChem CID 18487522) has the molecular formula C10H18N4O5 and a molecular weight of 274.28 g/mol. Its IUPAC name is 2-[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]propanoylamino]propanoic acid.
| Compound Name | 2-[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]propanoylamino]propanoic acid |
|---|---|
| PubChem CID | 18487522 |
| Molecular Formula | C10H18N4O5 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 2-[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]propanoylamino]propanoic acid |
| SMILES | CC(NC(=O)C(C)NC(=O)CNC(=O)CN)C(=O)O |
| InChI | InChI=1S/C10H18N4O5/c1-5(9(17)14-6(2)10(18)19)13-8(16)4-12-7(15)3-11/h5-6H,3-4,11H2,1-2H3,(H,12,15)(H,13,16)(H,14,17)(H,18,19) |
| InChIKey | SWXPPIZGWFVHJR-UHFFFAOYSA-N |
| XLogP | -2.84 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | -2.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |