C12H27N3O2 — CID 162738491
N-[2-(dimethylamino)-2-oxoethyl]-3-methyl-2-(methylamino)butanamide;ethane (PubChem CID 162738491) has the molecular formula C12H27N3O2 and a molecular weight of 245.37 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-oxoethyl]-3-methyl-2-(methylamino)butanamide;ethane.
| Compound Name | N-[2-(dimethylamino)-2-oxoethyl]-3-methyl-2-(methylamino)butanamide;ethane |
|---|---|
| PubChem CID | 162738491 |
| Molecular Formula | C12H27N3O2 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | N-[2-(dimethylamino)-2-oxoethyl]-3-methyl-2-(methylamino)butanamide;ethane |
| SMILES | CC.CNC(C(=O)NCC(=O)N(C)C)C(C)C |
| InChI | InChI=1S/C10H21N3O2.C2H6/c1-7(2)9(11-3)10(15)12-6-8(14)13(4)5;1-2/h7,9,11H,6H2,1-5H3,(H,12,15);1-2H3 |
| InChIKey | FWAITOTZUYZHAD-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |