C18H32N4O2 — CID 163289881
ethane;3-methyl-2-(methylamino)-N-[2-[4-(methylaminomethyl)anilino]-2-oxoethyl]butanamide (PubChem CID 163289881) has the molecular formula C18H32N4O2 and a molecular weight of 336.48 g/mol. Its IUPAC name is ethane;3-methyl-2-(methylamino)-N-[2-[4-(methylaminomethyl)anilino]-2-oxoethyl]butanamide.
| Compound Name | ethane;3-methyl-2-(methylamino)-N-[2-[4-(methylaminomethyl)anilino]-2-oxoethyl]butanamide |
|---|---|
| PubChem CID | 163289881 |
| Molecular Formula | C18H32N4O2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | ethane;3-methyl-2-(methylamino)-N-[2-[4-(methylaminomethyl)anilino]-2-oxoethyl]butanamide |
| SMILES | CC.CNCc1ccc(NC(=O)CNC(=O)C(NC)C(C)C)cc1 |
| InChI | InChI=1S/C16H26N4O2.C2H6/c1-11(2)15(18-4)16(22)19-10-14(21)20-13-7-5-12(6-8-13)9-17-3;1-2/h5-8,11,15,17-18H,9-10H2,1-4H3,(H,19,22)(H,20,21);1-2H3 |
| InChIKey | RLUXBGKKHUTUOO-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |