About (2S)-N,3-dimethyl-2-(3-methylbutanoylamino)butanamide;ethane;molecular hydrogen
(2S)-N,3-dimethyl-2-(3-methylbutanoylamino)butanamide;ethane;molecular hydrogen (PubChem CID 169106352) has the molecular formula C13H30N2O2
and a molecular weight of 246.39 g/mol. Its IUPAC name is (2S)-N,3-dimethyl-2-(3-methylbutanoylamino)butanamide;ethane;molecular hydrogen.
Molecular Properties
| Compound Name | (2S)-N,3-dimethyl-2-(3-methylbutanoylamino)butanamide;ethane;molecular hydrogen |
| PubChem CID | 169106352 |
| Molecular Formula | C13H30N2O2 |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.23 |
| IUPAC Name | (2S)-N,3-dimethyl-2-(3-methylbutanoylamino)butanamide;ethane;molecular hydrogen |
| SMILES | CC.CNC(=O)[C@@H](NC(=O)CC(C)C)C(C)C.[H][H] |
| InChI | InChI=1S/C11H22N2O2.C2H6.H2/c1-7(2)6-9(14)13-10(8(3)4)11(15)12-5;1-2;/h7-8,10H,6H2,1-5H3,(H,12,15)(H,13,14);1-2H3;1H/t10-;;/m0../s1 |
| InChIKey | HOKHSMDTLWHHJD-XRIOVQLTSA-N |
| XLogP | 2.19 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-N,3-dimethyl-2-(3-methylbutanoylamino)butanamide;ethane;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N,3-dimethyl-2-(3-methylbutanoylamino)butanamide;ethane;molecular hydrogen?
The IUPAC name of (2S)-N,3-dimethyl-2-(3-methylbutanoylamino)butanamide;ethane;molecular hydrogen (CID 169106352) is (2S)-N,3-dimethyl-2-(3-methylbutanoylamino)butanamide;ethane;molecular hydrogen.
What is the SMILES notation for (2S)-N,3-dimethyl-2-(3-methylbutanoylamino)butanamide;ethane;molecular hydrogen?
The canonical SMILES for (2S)-N,3-dimethyl-2-(3-methylbutanoylamino)butanamide;ethane;molecular hydrogen is CC.CNC(=O)[C@@H](NC(=O)CC(C)C)C(C)C.[H][H].
What is the InChIKey of (2S)-N,3-dimethyl-2-(3-methylbutanoylamino)butanamide;ethane;molecular hydrogen?
The InChIKey is HOKHSMDTLWHHJD-XRIOVQLTSA-N. The full InChI is InChI=1S/C11H22N2O2.C2H6.H2/c1-7(2)6-9(14)13-10(8(3)4)11(15)12-5;1-2;/h7-8,10H,6H2,1-5H3,(H,12,15)(H,13,14);1-2H3;1H/t10-;;/m0../s1.
What are the key properties of (2S)-N,3-dimethyl-2-(3-methylbutanoylamino)butanamide;ethane;molecular hydrogen?
(2S)-N,3-dimethyl-2-(3-methylbutanoylamino)butanamide;ethane;molecular hydrogen has a molecular weight of 246.39 g/mol, XLogP of 2.19, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N,3-dimethyl-2-(3-methylbutanoylamino)butanamide;ethane;molecular hydrogen is sourced from PubChem (CID 169106352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).