C12H27N3O2S — CID 170585957
N,3-dimethyl-2-[[2-[methyl(sulfanyl)amino]acetyl]amino]butanamide;propane (PubChem CID 170585957) has the molecular formula C12H27N3O2S and a molecular weight of 277.43 g/mol. Its IUPAC name is N,3-dimethyl-2-[[2-[methyl(sulfanyl)amino]acetyl]amino]butanamide;propane.
| Compound Name | N,3-dimethyl-2-[[2-[methyl(sulfanyl)amino]acetyl]amino]butanamide;propane |
|---|---|
| PubChem CID | 170585957 |
| Molecular Formula | C12H27N3O2S |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | N,3-dimethyl-2-[[2-[methyl(sulfanyl)amino]acetyl]amino]butanamide;propane |
| SMILES | CCC.CNC(=O)C(NC(=O)CN(C)S)C(C)C |
| InChI | InChI=1S/C9H19N3O2S.C3H8/c1-6(2)8(9(14)10-3)11-7(13)5-12(4)15;1-3-2/h6,8,15H,5H2,1-4H3,(H,10,14)(H,11,13);3H2,1-2H3 |
| InChIKey | TXORQIVUNBHJKC-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|