About N,3-dimethyl-2-[[2-[methyl(sulfanyl)amino]acetyl]amino]butanamide;propane
N,3-dimethyl-2-[[2-[methyl(sulfanyl)amino]acetyl]amino]butanamide;propane (PubChem CID 170585957) has the molecular formula C12H27N3O2S
and a molecular weight of 277.43 g/mol. Its IUPAC name is N,3-dimethyl-2-[[2-[methyl(sulfanyl)amino]acetyl]amino]butanamide;propane.
Molecular Properties
| Compound Name | N,3-dimethyl-2-[[2-[methyl(sulfanyl)amino]acetyl]amino]butanamide;propane |
| PubChem CID | 170585957 |
| Molecular Formula | C12H27N3O2S |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | N,3-dimethyl-2-[[2-[methyl(sulfanyl)amino]acetyl]amino]butanamide;propane |
| SMILES | CCC.CNC(=O)C(NC(=O)CN(C)S)C(C)C |
| InChI | InChI=1S/C9H19N3O2S.C3H8/c1-6(2)8(9(14)10-3)11-7(13)5-12(4)15;1-3-2/h6,8,15H,5H2,1-4H3,(H,10,14)(H,11,13);3H2,1-2H3 |
| InChIKey | TXORQIVUNBHJKC-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N,3-dimethyl-2-[[2-[methyl(sulfanyl)amino]acetyl]amino]butanamide;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,3-dimethyl-2-[[2-[methyl(sulfanyl)amino]acetyl]amino]butanamide;propane?
The IUPAC name of N,3-dimethyl-2-[[2-[methyl(sulfanyl)amino]acetyl]amino]butanamide;propane (CID 170585957) is N,3-dimethyl-2-[[2-[methyl(sulfanyl)amino]acetyl]amino]butanamide;propane.
What is the SMILES notation for N,3-dimethyl-2-[[2-[methyl(sulfanyl)amino]acetyl]amino]butanamide;propane?
The canonical SMILES for N,3-dimethyl-2-[[2-[methyl(sulfanyl)amino]acetyl]amino]butanamide;propane is CCC.CNC(=O)C(NC(=O)CN(C)S)C(C)C.
What is the InChIKey of N,3-dimethyl-2-[[2-[methyl(sulfanyl)amino]acetyl]amino]butanamide;propane?
The InChIKey is TXORQIVUNBHJKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N3O2S.C3H8/c1-6(2)8(9(14)10-3)11-7(13)5-12(4)15;1-3-2/h6,8,15H,5H2,1-4H3,(H,10,14)(H,11,13);3H2,1-2H3.
What are the key properties of N,3-dimethyl-2-[[2-[methyl(sulfanyl)amino]acetyl]amino]butanamide;propane?
N,3-dimethyl-2-[[2-[methyl(sulfanyl)amino]acetyl]amino]butanamide;propane has a molecular weight of 277.43 g/mol, XLogP of 1.07, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,3-dimethyl-2-[[2-[methyl(sulfanyl)amino]acetyl]amino]butanamide;propane is sourced from PubChem (CID 170585957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).