C14H27N3O3 — CID 62035731
2-[[2-(dimethylamino)-2-oxoethyl]-ethylamino]-N-(2-methyl-4-oxopentan-3-yl)acetamide (PubChem CID 62035731) has the molecular formula C14H27N3O3 and a molecular weight of 285.39 g/mol. Its IUPAC name is 2-[[2-(dimethylamino)-2-oxoethyl]-ethylamino]-N-(2-methyl-4-oxopentan-3-yl)acetamide.
| Compound Name | 2-[[2-(dimethylamino)-2-oxoethyl]-ethylamino]-N-(2-methyl-4-oxopentan-3-yl)acetamide |
|---|---|
| PubChem CID | 62035731 |
| Molecular Formula | C14H27N3O3 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | 2-[[2-(dimethylamino)-2-oxoethyl]-ethylamino]-N-(2-methyl-4-oxopentan-3-yl)acetamide |
| SMILES | CCN(CC(=O)NC(C(C)=O)C(C)C)CC(=O)N(C)C |
| InChI | InChI=1S/C14H27N3O3/c1-7-17(9-13(20)16(5)6)8-12(19)15-14(10(2)3)11(4)18/h10,14H,7-9H2,1-6H3,(H,15,19) |
| InChIKey | QKVHGTPRDPSIOH-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |