C10H19N3O — CID 61450794
2-[2-cyanopropyl(ethyl)amino]-N,N-dimethylacetamide (PubChem CID 61450794) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-[2-cyanopropyl(ethyl)amino]-N,N-dimethylacetamide.
| Compound Name | 2-[2-cyanopropyl(ethyl)amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 61450794 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 2-[2-cyanopropyl(ethyl)amino]-N,N-dimethylacetamide |
| SMILES | CCN(CC(=O)N(C)C)CC(C)C#N |
| InChI | InChI=1S/C10H19N3O/c1-5-13(7-9(2)6-11)8-10(14)12(3)4/h9H,5,7-8H2,1-4H3 |
| InChIKey | LAZFINNDOCGEIZ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |