C8H15N3O — CID 78969861
1-(2-cyanopropyl)-1,3,3-trimethylurea (PubChem CID 78969861) has the molecular formula C8H15N3O and a molecular weight of 169.23 g/mol. Its IUPAC name is 1-(2-cyanopropyl)-1,3,3-trimethylurea.
| Compound Name | 1-(2-cyanopropyl)-1,3,3-trimethylurea |
|---|---|
| PubChem CID | 78969861 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | 1-(2-cyanopropyl)-1,3,3-trimethylurea |
| SMILES | CC(C#N)CN(C)C(=O)N(C)C |
| InChI | InChI=1S/C8H15N3O/c1-7(5-9)6-11(4)8(12)10(2)3/h7H,6H2,1-4H3 |
| InChIKey | YETOLHXWJRKXBH-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |