C7H16N2O2 — CID 79153852
1-(2-hydroxypropyl)-1,3,3-trimethylurea (PubChem CID 79153852) has the molecular formula C7H16N2O2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 1-(2-hydroxypropyl)-1,3,3-trimethylurea.
| Compound Name | 1-(2-hydroxypropyl)-1,3,3-trimethylurea |
|---|---|
| PubChem CID | 79153852 |
| Molecular Formula | C7H16N2O2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.12 |
| IUPAC Name | 1-(2-hydroxypropyl)-1,3,3-trimethylurea |
| SMILES | CC(O)CN(C)C(=O)N(C)C |
| InChI | InChI=1S/C7H16N2O2/c1-6(10)5-9(4)7(11)8(2)3/h6,10H,5H2,1-4H3 |
| InChIKey | PPEUFMPVINPGHY-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |