2-[dimethylcarbamoyl(methyl)amino]acetic acid

C6H12N2O3 — CID 43135260

IUPAC2-[dimethylcarbamoyl(methyl)amino]acetic acid
SMILESCN(C)C(=O)N(C)CC(=O)O
InChIInChI=1S/C6H12N2O3/c1-7(2)6(11)8(3)4-5(9)10/h4H2,1-3H3,(H,9,10)
InChIKeyBDKOXNWWTXVYTB-UHFFFAOYSA-N
MW160.17 g/mol
LogP-0.32
Rot. Bonds2

About 2-[dimethylcarbamoyl(methyl)amino]acetic acid

2-[dimethylcarbamoyl(methyl)amino]acetic acid (PubChem CID 43135260) has the molecular formula C6H12N2O3 and a molecular weight of 160.17 g/mol. Its IUPAC name is 2-[dimethylcarbamoyl(methyl)amino]acetic acid.

Molecular Properties

Compound Name2-[dimethylcarbamoyl(methyl)amino]acetic acid
PubChem CID43135260
Molecular FormulaC6H12N2O3
Molecular Weight160.17 g/mol
Exact Mass160.08
IUPAC Name2-[dimethylcarbamoyl(methyl)amino]acetic acid
SMILESCN(C)C(=O)N(C)CC(=O)O
InChIInChI=1S/C6H12N2O3/c1-7(2)6(11)8(3)4-5(9)10/h4H2,1-3H3,(H,9,10)
InChIKeyBDKOXNWWTXVYTB-UHFFFAOYSA-N
XLogP-0.32
TPSA60.85 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500160.17
LogP ≤ 5-0.32
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-[dimethylcarbamoyl(methyl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

ethane;2-[methyl(propanoyl)amino]acetic acid
CID 170570723
2-[[2-hydroxypropyl(methyl)carbamoyl]-methylamino]acetic acid
CID 62338542
2-[bis(carboxymethyl)amino]acetic acid;N,N-dimethylmethanamine
CID 88838366
2-[carboxymethyl(methyl)amino]-2-oxoacetic acid
CID 14985601
2-[[2-cyanoethyl(methyl)carbamoyl]-methylamino]acetic acid
CID 43135817
2-[[cyclopentylmethyl(methyl)carbamoyl]-methylamino]acetic acid
CID 63656971
2-[[2-hydroxyethyl(propyl)carbamoyl]-methylamino]acetic acid
CID 61425586
2-[bis(carboxymethyl)amino]acetic acid
CID 22440005
2-[[[2-(cyclopropylamino)-2-oxoethyl]-methylcarbamoyl]-methylamino]acetic acid
CID 55003311
azane;2-(dimethylamino)acetic acid
CID 172828475
2-[[2-[acetyl(methyl)amino]acetyl]-methylamino]acetic acid
CID 43356271
2-[methyl-(2,2,2-trichloroacetyl)amino]acetic acid
CID 21402666

Frequently Asked Questions

What is the IUPAC name of 2-[dimethylcarbamoyl(methyl)amino]acetic acid?
The IUPAC name of 2-[dimethylcarbamoyl(methyl)amino]acetic acid (CID 43135260) is 2-[dimethylcarbamoyl(methyl)amino]acetic acid.
What is the SMILES notation for 2-[dimethylcarbamoyl(methyl)amino]acetic acid?
The canonical SMILES for 2-[dimethylcarbamoyl(methyl)amino]acetic acid is CN(C)C(=O)N(C)CC(=O)O.
What is the InChIKey of 2-[dimethylcarbamoyl(methyl)amino]acetic acid?
The InChIKey is BDKOXNWWTXVYTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O3/c1-7(2)6(11)8(3)4-5(9)10/h4H2,1-3H3,(H,9,10).
What are the key properties of 2-[dimethylcarbamoyl(methyl)amino]acetic acid?
2-[dimethylcarbamoyl(methyl)amino]acetic acid has a molecular weight of 160.17 g/mol, XLogP of -0.32, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[dimethylcarbamoyl(methyl)amino]acetic acid is sourced from PubChem (CID 43135260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).