C8H13N3O3 — CID 43135817
2-[[2-cyanoethyl(methyl)carbamoyl]-methylamino]acetic acid (PubChem CID 43135817) has the molecular formula C8H13N3O3 and a molecular weight of 199.21 g/mol. Its IUPAC name is 2-[[2-cyanoethyl(methyl)carbamoyl]-methylamino]acetic acid.
| Compound Name | 2-[[2-cyanoethyl(methyl)carbamoyl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 43135817 |
| Molecular Formula | C8H13N3O3 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 2-[[2-cyanoethyl(methyl)carbamoyl]-methylamino]acetic acid |
| SMILES | CN(CCC#N)C(=O)N(C)CC(=O)O |
| InChI | InChI=1S/C8H13N3O3/c1-10(5-3-4-9)8(14)11(2)6-7(12)13/h3,5-6H2,1-2H3,(H,12,13) |
| InChIKey | LHAVWSFSTQPTSC-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |