N-(2-cyanoethyl)-N-methylcarbamoyl chloride

C5H7ClN2O — CID 54246845

IUPACN-(2-cyanoethyl)-N-methylcarbamoyl chloride
SMILESCN(CCC#N)C(=O)Cl
InChIInChI=1S/C5H7ClN2O/c1-8(5(6)9)4-2-3-7/h2,4H2,1H3
InChIKeyQTWAPOBZRHVFAY-UHFFFAOYSA-N
MW146.58 g/mol
LogP1.19
Rot. Bonds2

About N-(2-cyanoethyl)-N-methylcarbamoyl chloride

N-(2-cyanoethyl)-N-methylcarbamoyl chloride (PubChem CID 54246845) has the molecular formula C5H7ClN2O and a molecular weight of 146.58 g/mol. Its IUPAC name is N-(2-cyanoethyl)-N-methylcarbamoyl chloride.

Molecular Properties

Compound NameN-(2-cyanoethyl)-N-methylcarbamoyl chloride
PubChem CID54246845
Molecular FormulaC5H7ClN2O
Molecular Weight146.58 g/mol
Exact Mass146.02
IUPAC NameN-(2-cyanoethyl)-N-methylcarbamoyl chloride
SMILESCN(CCC#N)C(=O)Cl
InChIInChI=1S/C5H7ClN2O/c1-8(5(6)9)4-2-3-7/h2,4H2,1H3
InChIKeyQTWAPOBZRHVFAY-UHFFFAOYSA-N
XLogP1.19
TPSA44.10 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500146.58
LogP ≤ 51.19
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}

Analyze N-(2-cyanoethyl)-N-methylcarbamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-(2-cyanoethyl)-N-methylcarbamoyl chloride?
The IUPAC name of N-(2-cyanoethyl)-N-methylcarbamoyl chloride (CID 54246845) is N-(2-cyanoethyl)-N-methylcarbamoyl chloride.
What is the SMILES notation for N-(2-cyanoethyl)-N-methylcarbamoyl chloride?
The canonical SMILES for N-(2-cyanoethyl)-N-methylcarbamoyl chloride is CN(CCC#N)C(=O)Cl.
What is the InChIKey of N-(2-cyanoethyl)-N-methylcarbamoyl chloride?
The InChIKey is QTWAPOBZRHVFAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7ClN2O/c1-8(5(6)9)4-2-3-7/h2,4H2,1H3.
What are the key properties of N-(2-cyanoethyl)-N-methylcarbamoyl chloride?
N-(2-cyanoethyl)-N-methylcarbamoyl chloride has a molecular weight of 146.58 g/mol, XLogP of 1.19, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-cyanoethyl)-N-methylcarbamoyl chloride is sourced from PubChem (CID 54246845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).