C13H23N3O3 — CID 54925440
4-[[2-[2-cyanoethyl(methyl)amino]-2-oxoethyl]-propan-2-ylamino]butanoic acid (PubChem CID 54925440) has the molecular formula C13H23N3O3 and a molecular weight of 269.34 g/mol. Its IUPAC name is 4-[[2-[2-cyanoethyl(methyl)amino]-2-oxoethyl]-propan-2-ylamino]butanoic acid.
| Compound Name | 4-[[2-[2-cyanoethyl(methyl)amino]-2-oxoethyl]-propan-2-ylamino]butanoic acid |
|---|---|
| PubChem CID | 54925440 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | 4-[[2-[2-cyanoethyl(methyl)amino]-2-oxoethyl]-propan-2-ylamino]butanoic acid |
| SMILES | CC(C)N(CCCC(=O)O)CC(=O)N(C)CCC#N |
| InChI | InChI=1S/C13H23N3O3/c1-11(2)16(9-4-6-13(18)19)10-12(17)15(3)8-5-7-14/h11H,4-6,8-10H2,1-3H3,(H,18,19) |
| InChIKey | JFDQJMHUIYBTDT-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |