C10H19N3O — CID 82017217
5-amino-N-(2-cyanoethyl)-N,4-dimethylpentanamide (PubChem CID 82017217) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is 5-amino-N-(2-cyanoethyl)-N,4-dimethylpentanamide.
| Compound Name | 5-amino-N-(2-cyanoethyl)-N,4-dimethylpentanamide |
|---|---|
| PubChem CID | 82017217 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 5-amino-N-(2-cyanoethyl)-N,4-dimethylpentanamide |
| SMILES | CC(CN)CCC(=O)N(C)CCC#N |
| InChI | InChI=1S/C10H19N3O/c1-9(8-12)4-5-10(14)13(2)7-3-6-11/h9H,3-5,7-8,12H2,1-2H3 |
| InChIKey | NGCBDLFXWSJRFS-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 70.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |