C12H26N2O2 — CID 107199347
5-amino-N-(5-hydroxypentyl)-N,4-dimethylpentanamide (PubChem CID 107199347) has the molecular formula C12H26N2O2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 5-amino-N-(5-hydroxypentyl)-N,4-dimethylpentanamide.
| Compound Name | 5-amino-N-(5-hydroxypentyl)-N,4-dimethylpentanamide |
|---|---|
| PubChem CID | 107199347 |
| Molecular Formula | C12H26N2O2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | 5-amino-N-(5-hydroxypentyl)-N,4-dimethylpentanamide |
| SMILES | CC(CN)CCC(=O)N(C)CCCCCO |
| InChI | InChI=1S/C12H26N2O2/c1-11(10-13)6-7-12(16)14(2)8-4-3-5-9-15/h11,15H,3-10,13H2,1-2H3 |
| InChIKey | OWXYXDUXJHHFDL-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|